EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O5 |
| Net Charge | 0 |
| Average Mass | 294.307 |
| Monoisotopic Mass | 294.12157 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O5/c15-10(13(18)19)6-7-12(17)16-11(14(20)21)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,15H2,(H,16,17)(H,18,19)(H,20,21)/t10-,11-/m0/s1 |
| InChIKey | XHHOHZPNYFQJKL-QWRGUYRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (466810) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Phe (CHEBI:89582) has role human urinary metabolite (CHEBI:84087) |
| γ-Glu-Phe (CHEBI:89582) is a dipeptide (CHEBI:46761) |
| γ-Glu-Phe (CHEBI:89582) is conjugate acid of γ-Glu-Phe(1−) (CHEBI:133692) |
| Incoming Relation(s) |
| γ-Glu-Phe(1−) (CHEBI:133692) is conjugate base of γ-Glu-Phe (CHEBI:89582) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-{[(1S)-1-carboxy-2-phenylethyl]carbamoyl}butanoic acid | HMDB |
| gamma-Glu-phe | HMDB |
| gamma-Glutamylphenylalanine | ChemIDplus |
| L-gamma-Glutamyl-L-phenylalanine | HMDB |
| N-(gamma-L-Glutamyl)phenylalanine | HMDB |
| N-L-gamma-Glutamyl-3-phenyl-L-alanine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000594 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2820776 | Reaxys |
| CAS:7432-24-8 | ChemIDplus |
| Citations |
|---|