EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N2O5 |
| Net Charge | -1 |
| Average Mass | 293.299 |
| Monoisotopic Mass | 293.11430 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](Cc1ccccc1)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C14H18N2O5/c15-10(13(18)19)6-7-12(17)16-11(14(20)21)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,15H2,(H,16,17)(H,18,19)(H,20,21)/p-1/t10-,11-/m0/s1 |
| InChIKey | XHHOHZPNYFQJKL-QWRGUYRKSA-M |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Phe(1−) (CHEBI:133692) has role human urinary metabolite (CHEBI:84087) |
| γ-Glu-Phe(1−) (CHEBI:133692) is a peptide anion (CHEBI:60334) |
| γ-Glu-Phe(1−) (CHEBI:133692) is conjugate base of γ-Glu-Phe (CHEBI:89582) |
| Incoming Relation(s) |
| γ-Glu-Phe (CHEBI:89582) is conjugate acid of γ-Glu-Phe(1−) (CHEBI:133692) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S)-1-carboxylato-2-phenylethyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| L-γ-Glu-L-Phe(1−) | ChEBI |
| L-γ-glutamyl-L-phenylalaninate | ChEBI |
| γ-glutamylphenylalaninate | ChEBI |