EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O |
| Net Charge | 0 |
| Average Mass | 388.680 |
| Monoisotopic Mass | 388.37052 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCCC(C)C)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C27H48O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h18-25,28H,6-17H2,1-5H3/t19-,20-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | QYIXCDOBOSTCEI-NWKZBHTNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | |
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (24029555) | |
| Homo Sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (12092571) |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coprostanol (CHEBI:89519) has parent hydride 5β-cholestane (CHEBI:35517) |
| coprostanol (CHEBI:89519) has role environmental contaminant (CHEBI:78298) |
| coprostanol (CHEBI:89519) has role human urinary metabolite (CHEBI:84087) |
| coprostanol (CHEBI:89519) has role plant metabolite (CHEBI:76924) |
| coprostanol (CHEBI:89519) is a 3-hydroxy steroid (CHEBI:36834) |
| coprostanol (CHEBI:89519) is a cholestanoid (CHEBI:50401) |
| coprostanol (CHEBI:89519) is a phytosterols (CHEBI:26125) |
| Incoming Relation(s) |
| 24-ethylcoprostanol (CHEBI:133627) has functional parent coprostanol (CHEBI:89519) |
| IUPAC Name |
|---|
| 5β-cholestan-3β-ol |
| Synonyms | Source |
|---|---|
| (3β,5β)-cholestan-3-ol | IUPAC |
| 5beta-cholestan-3beta-ol | HMDB |
| 5beta Coprostanol | HMDB |
| coprosterol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 191826 | ChemSpider |
| Coprosterol | Wikipedia |
| HMDB0000577 | HMDB |
| LMST01010078 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3207912 | Reaxys |
| CAS:360-68-9 | HMDB |
| Citations |
|---|