EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H52O |
| Net Charge | 0 |
| Average Mass | 416.734 |
| Monoisotopic Mass | 416.40182 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(CC)C(C)C)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C29H52O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h19-27,30H,7-18H2,1-6H3/t20-,21?,22-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | LGJMUZUPVCAVPU-OKGOGUTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-ethylcoprostanol (CHEBI:133627) has functional parent coprostanol (CHEBI:89519) |
| 24-ethylcoprostanol (CHEBI:133627) has role plant metabolite (CHEBI:76924) |
| 24-ethylcoprostanol (CHEBI:133627) is a 3-hydroxy steroid (CHEBI:36834) |
| 24-ethylcoprostanol (CHEBI:133627) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (3β,5β,24ξ)-stigmastan-3-ol |
| Synonym | Source |
|---|---|
| 24-ethyl-5β-cholestan-3β-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6276638 | Reaxys |