EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N2O2 |
| Net Charge | +1 |
| Average Mass | 161.225 |
| Monoisotopic Mass | 161.12845 |
| SMILES | [NH3+]CCCCNCCC(=O)O |
| InChI | InChI=1S/C7H16N2O2/c8-4-1-2-5-9-6-3-7(10)11/h9H,1-6,8H2,(H,10,11)/p+1 |
| InChIKey | BTSHXVLJDRJCMM-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (3757213) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Putreanine (CHEBI:89478) has functional parent β-amino acid (CHEBI:33706) |
| Putreanine (CHEBI:89478) is a organonitrogen compound (CHEBI:35352) |
| Putreanine (CHEBI:89478) is a organooxygen compound (CHEBI:36963) |
| Putreanine (CHEBI:89478) is tautomer of putreanine(1+) (CHEBI:180912) |
| Incoming Relation(s) |
| putreanine(1+) (CHEBI:180912) is tautomer of Putreanine (CHEBI:89478) |
| Synonyms | Source |
|---|---|
| N-(4-Aminobutyl)-beta-Alanine | HMDB |
| 3-[(4-azaniumylbutyl)amino]propanoic acid | HMDB |
| N-(2-Carboxyethyl)putrescine | HMDB |
| N-(4-Aminobutyl)-3-aminopropionic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006078 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:25887-39-2 | KEGG COMPOUND |
| Citations |
|---|