EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N2O2 |
| Net Charge | +1 |
| Average Mass | 161.225 |
| Monoisotopic Mass | 161.12845 |
| SMILES | [NH3+]CCCC[NH2+]CCC(=O)[O-] |
| InChI | InChI=1S/C7H16N2O2/c8-4-1-2-5-9-6-3-7(10)11/h9H,1-6,8H2,(H,10,11)/p+1 |
| InChIKey | BTSHXVLJDRJCMM-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| putreanine(1+) (CHEBI:180912) is a N-substituted putrescine (CHEBI:26406) |
| putreanine(1+) (CHEBI:180912) is a carboxylic acid anion (CHEBI:29067) |
| putreanine(1+) (CHEBI:180912) is tautomer of Putreanine (CHEBI:89478) |
| Incoming Relation(s) |
| Putreanine (CHEBI:89478) is tautomer of putreanine(1+) (CHEBI:180912) |
| UniProt Name | Source |
|---|---|
| N-(2-carboxyethyl)putrescine | UniProt |