EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N6O5S |
| Net Charge | 0 |
| Average Mass | 384.418 |
| Monoisotopic Mass | 384.12159 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N6O5S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7+,9+,10+,13+/m0/s1 |
| InChIKey | ZJUKTBDSGOFHSH-WFMPWKQPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.1.1.72 [site-specific DNA-methyltransferase (adenine-specific)] inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of site-specific DNA-methyltransferase (adenine-specific), EC 2.1.1.72. EC 2.1.1.79 (cyclopropane-fatty-acyl-phospholipid synthase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of cyclopropane fatty acid synthase (EC 2.1.1.79). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). fundamental metabolite Any metabolite produced by all living cells. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role cofactor (CHEBI:23357) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role EC 2.1.1.72 [site-specific DNA-methyltransferase (adenine-specific)] inhibitor (CHEBI:65065) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role EC 2.1.1.79 (cyclopropane-fatty-acyl-phospholipid synthase) inhibitor (CHEBI:65064) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role epitope (CHEBI:53000) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role fundamental metabolite (CHEBI:78675) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a adenosines (CHEBI:22260) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a homocysteine derivative (CHEBI:136505) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a homocysteines (CHEBI:24610) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a organic sulfide (CHEBI:16385) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is conjugate acid of S-adenosyl-L-homocysteinate (CHEBI:67009) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is tautomer of S-adenosyl-L-homocysteine zwitterion (CHEBI:57856) |
| Incoming Relation(s) |
| S-adenosyl-L-homocysteinate (CHEBI:67009) is conjugate base of S-adenosyl-L-homocysteine (CHEBI:16680) |
| S-adenosyl-L-homocysteine zwitterion (CHEBI:57856) is tautomer of S-adenosyl-L-homocysteine (CHEBI:16680) |
| IUPAC Name |
|---|
| S-(5'-deoxyadenosin-5'-yl)-L-homocysteine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-({[(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl}sulfanyl)butanoic acid | PDBeChem |
| 2-S-adenosyl-L-homocysteine | HMDB |
| adenosylhomocysteine | MetaCyc |
| Adenosyl-L-homocysteine | HMDB |
| AdoHcy | ChEBI |
| S-[1-(adenin-9-yl)-1,5-dideoxy-β-D-ribofuranos-5-yl]-L-homocysteine | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| ADENOSYL-HOMO-CYS | MetaCyc |
| C00007230 | KNApSAcK |
| C00021 | KEGG COMPOUND |
| DB01752 | DrugBank |
| HMDB0000939 | HMDB |
| S-Adenosyl-L-homocysteine | Wikipedia |
| SAH | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Gmelin:692100 | Gmelin |
| Reaxys:99188 | Reaxys |
| CAS:979-92-0 | KEGG COMPOUND |
| CAS:979-92-0 | ChemIDplus |
| Citations |
|---|