EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N6O5S |
| Net Charge | -1 |
| Average Mass | 383.410 |
| Monoisotopic Mass | 383.11431 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCC[C@H](N)C(=O)[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N6O5S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/p-1/t6-,7+,9+,10+,13+/m0/s1 |
| InChIKey | ZJUKTBDSGOFHSH-WFMPWKQPSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-adenosyl-L-homocysteinate (CHEBI:67009) has role fundamental metabolite (CHEBI:78675) |
| S-adenosyl-L-homocysteinate (CHEBI:67009) is a L-α-amino acid anion (CHEBI:59814) |
| S-adenosyl-L-homocysteinate (CHEBI:67009) is conjugate base of S-adenosyl-L-homocysteine (CHEBI:16680) |
| Incoming Relation(s) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is conjugate acid of S-adenosyl-L-homocysteinate (CHEBI:67009) |
| IUPAC Name |
|---|
| 5'-S-[(3S)-3-amino-3-carboxylatopropyl]-5'-thioadenosine |