EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O4 |
| Net Charge | 0 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02661 |
| SMILES | O=C(O)c1ccc(CO)o1 |
| InChI | InChI=1S/C6H6O4/c7-3-4-1-2-5(10-4)6(8)9/h1-2,7H,3H2,(H,8,9) |
| InChIKey | PCSKKIUURRTAEM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (17542490) | |
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (8087979) | ||
| faeces (UBERON:0001988) | PubMed (24029555) | ||
| - | MetaboLights (MTBLS101) | ||
| - | PubMed (24023812) | ||
| Komagataeibacter xylinus (ncbitaxon:28448) | - | PubMed (25186182) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| Application: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role fungal metabolite (CHEBI:76946) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role human urinary metabolite (CHEBI:84087) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role nematicide (CHEBI:25491) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) is a aromatic primary alcohol (CHEBI:33857) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-(hydroxymethyl)furan-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-Hydroxymethyl-2-furancarboxylic acid | HMDB |
| 5-(Hydroxymethyl)-2-furoic acid | HMDB |
| 5-Hydroxymethyl-furan-2-carboxylic acid | HMDB |
| 5-Hydroxymethylfuran-2-carboxylic acid | HMDB |
| 5-Hydroxymethylfuranoic acid | HMDB |
| 5-Hydroxymethylfuroic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C20448 | KEGG COMPOUND |
| CPD-14103 | MetaCyc |
| HMDB0002432 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:121784 | Reaxys |
| CAS:6338-41-6 | KEGG COMPOUND |
| CAS:6338-41-6 | ChemIDplus |
| Citations |
|---|