EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O4 |
| Net Charge | 0 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02661 |
| SMILES | O=C(O)c1ccc(CO)o1 |
| InChI | InChI=1S/C6H6O4/c7-3-4-1-2-5(10-4)6(8)9/h1-2,7H,3H2,(H,8,9) |
| InChIKey | PCSKKIUURRTAEM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (17542490) | |
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (8087979) | ||
| faeces (UBERON:0001988) | PubMed (24029555) | ||
| - | MetaboLights (MTBLS101) | ||
| - | PubMed (24023812) | ||
| Komagataeibacter xylinus (ncbitaxon:28448) | - | PubMed (25186182) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| Application: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role fungal metabolite (CHEBI:76946) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role human urinary metabolite (CHEBI:84087) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) has role nematicide (CHEBI:25491) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) is a aromatic primary alcohol (CHEBI:33857) |
| 5-hydroxymethyl-2-furoic acid (CHEBI:89118) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-(hydroxymethyl)furan-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-Hydroxymethyl-2-furancarboxylic acid | HMDB |
| 5-(Hydroxymethyl)-2-furoic acid | HMDB |
| 5-Hydroxymethyl-furan-2-carboxylic acid | HMDB |
| 5-Hydroxymethylfuran-2-carboxylic acid | HMDB |
| 5-Hydroxymethylfuranoic acid | HMDB |
| 5-Hydroxymethylfuroic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C20448 | KEGG COMPOUND |
| CPD-14103 | MetaCyc |
| HMDB0002432 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:121784 | Reaxys |
| CAS:6338-41-6 | KEGG COMPOUND |
| CAS:6338-41-6 | ChemIDplus |
| Citations |
|---|