EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | COc1cc(O)c2c(O)c3c(=O)cc(C)oc3cc2c1 |
| InChI | InChI=1S/C15H12O5/c1-7-3-10(16)14-12(20-7)5-8-4-9(19-2)6-11(17)13(8)15(14)18/h3-6,17-18H,1-2H3 |
| InChIKey | FPNKCZKRICBAKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubrofusarin (CHEBI:8908) has role biological pigment (CHEBI:26130) |
| rubrofusarin (CHEBI:8908) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| rubrofusarin (CHEBI:8908) has role fungal metabolite (CHEBI:76946) |
| rubrofusarin (CHEBI:8908) is a aromatic ether (CHEBI:35618) |
| rubrofusarin (CHEBI:8908) is a benzochromenone (CHEBI:64986) |
| rubrofusarin (CHEBI:8908) is a phenols (CHEBI:33853) |
| rubrofusarin (CHEBI:8908) is a polyketide (CHEBI:26188) |
| rubrofusarin (CHEBI:8908) is conjugate acid of rubrofusarin(1−) (CHEBI:145894) |
| Incoming Relation(s) |
| rubrofusarin B (CHEBI:133805) has functional parent rubrofusarin (CHEBI:8908) |
| rubrofusarin(1−) (CHEBI:145894) is conjugate base of rubrofusarin (CHEBI:8908) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-8-methoxy-2-methyl-4H-benzo[g]chromen-4-one |
| Synonym | Source |
|---|---|
| NSC 258316 | ChemIDplus |
| Citations |
|---|