EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1cc(OC)c2c(O)c3c(=O)cc(C)oc3cc2c1 |
| InChI | InChI=1S/C16H14O5/c1-8-4-11(17)15-13(21-8)6-9-5-10(19-2)7-12(20-3)14(9)16(15)18/h4-7,18H,1-3H3 |
| InChIKey | HFPQKJMLIONCGP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fonsecaeus | - | PubMed (4837062) | |
| Aspergillus tubingensis (ncbitaxon:5068) | |||
| - | PubMed (26610038) | from fermentation of Aspergillus tubingensis in Lycium ruthenicum | |
| - | PubMed (20506081) | Isolated from Pongamia pinnata | |
| Alternaria alternata (ncbitaxon:5599) | - | PubMed (22377027) | isolated from the marine soft coral Denderonephthya hemprichi |
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (15556711) | An endophyte in Cyndon dactylon Strain: IFB-E003 |
| Cladosporium herbarum (ncbitaxon:29918) | - | PubMed (16038560) | Associated with Cynodon dactylon Strain: IFB-E002 |
| Guanomyces polythrix (ncbitaxon:110160) | - | PubMed (10869195) | By fractionation of the fermentation broth and mycelium |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubrofusarin B (CHEBI:133805) has functional parent rubrofusarin (CHEBI:8908) |
| rubrofusarin B (CHEBI:133805) has role Aspergillus metabolite (CHEBI:76956) |
| rubrofusarin B (CHEBI:133805) is a aromatic ether (CHEBI:35618) |
| rubrofusarin B (CHEBI:133805) is a benzochromenone (CHEBI:64986) |
| rubrofusarin B (CHEBI:133805) is a naphtho-γ-pyrone (CHEBI:64542) |
| rubrofusarin B (CHEBI:133805) is a phenols (CHEBI:33853) |
| rubrofusarin B (CHEBI:133805) is a polyketide (CHEBI:26188) |
| rubrofusarin B (CHEBI:133805) is conjugate acid of rubrofusarin B(1−) (CHEBI:145920) |
| Incoming Relation(s) |
| rubrofusarin B(1−) (CHEBI:145920) is conjugate base of rubrofusarin B (CHEBI:133805) |
| IUPAC Name |
|---|
| 5-hydroxy-6,8-dimethoxy-2-methyl-4H-benzo[g]chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-6,8-dimethoxy-2-methyl-4H-naphtho(2,3-b)pyran-4-one | ChemIDplus |
| TMD-256a2 | ChemIDplus |
| heminigerone | ChemIDplus |
| TMD 256a2 | ChemIDplus |
| rubrofusarin monomethyl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 154084 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1293594 | Reaxys |
| CAS:17276-15-2 | ChemIDplus |
| Citations |
|---|