EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O |
| Net Charge | 0 |
| Average Mass | 552.887 |
| Monoisotopic Mass | 552.43312 |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C40H56O/c1-31(2)17-13-20-34(5)23-15-25-35(6)24-14-21-32(3)18-11-12-19-33(4)22-16-26-36(7)27-28-39-37(8)29-38(41)30-40(39,9)10/h11-12,14-19,21-28,38,41H,13,20,29-30H2,1-10H3/b12-11+,21-14+,22-16+,25-15+,28-27+,32-18+,33-19+,34-23+,35-24+,36-26+/t38-/m1/s1 |
| InChIKey | ABTRFGSPYXCGMR-AXXBKCDFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Application: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubixanthin (CHEBI:8907) has parent hydride γ-carotene (CHEBI:27740) |
| rubixanthin (CHEBI:8907) has role food colouring (CHEBI:77182) |
| rubixanthin (CHEBI:8907) has role plant metabolite (CHEBI:76924) |
| rubixanthin (CHEBI:8907) is a carotenol (CHEBI:23045) |
| IUPAC Name |
|---|
| (3R)-β,ψ-caroten-3-ol |
| Synonyms | Source |
|---|---|
| Rubixanthin | KEGG COMPOUND |
| Natural yellow 27 | ChemIDplus |
| (all-E,3R)-rubixanthin | ChEBI |
| E 161d | ChEBI |
| E161d | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08611 | KEGG COMPOUND |
| LMPR01070281 | LIPID MAPS |
| Rubixanthin | Wikipedia |
| HMDB0035836 | HMDB |
| C00003785 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2342671 | Reaxys |
| CAS:3763-55-1 | KEGG COMPOUND |
| CAS:3763-55-1 | ChemIDplus |
| Citations |
|---|