EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56 |
| Net Charge | 0 |
| Average Mass | 536.888 |
| Monoisotopic Mass | 536.43820 |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H56/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h11-12,14-16,18-20,22-27,29-30H,13,17,21,28,31H2,1-10H3/b12-11+,22-14+,23-16+,26-15+,30-29+,33-19+,34-20+,35-24+,36-25+,37-27+ |
| InChIKey | HRQKOYFGHJYEFS-BXOLYSJBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-carotene (CHEBI:27740) has role fungal metabolite (CHEBI:76946) |
| γ-carotene (CHEBI:27740) has role plant metabolite (CHEBI:76924) |
| γ-carotene (CHEBI:27740) is a carotenoid β-end derivative (CHEBI:139120) |
| γ-carotene (CHEBI:27740) is a cyclic carotene (CHEBI:35163) |
| Incoming Relation(s) |
| 1'-hydroxy-γ-carotene (CHEBI:80133) has parent hydride γ-carotene (CHEBI:27740) |
| rubixanthin (CHEBI:8907) has parent hydride γ-carotene (CHEBI:27740) |
| IUPAC Name |
|---|
| β,ψ-carotene |
| Synonym | Source |
|---|---|
| gamma-Carotene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| γ-carotene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000926 | KNApSAcK |
| C05435 | KEGG COMPOUND |
| C05435 | KEGG COMPOUND |
| CPD1F-126 | MetaCyc |
| Gamma-carotene | Wikipedia |
| LMPR01070260 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2066713 | Reaxys |
| CAS:472-93-5 | ChemIDplus |
| Citations |
|---|