EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N2O |
| Net Charge | 0 |
| Average Mass | 274.408 |
| Monoisotopic Mass | 274.20451 |
| SMILES | CCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H26N2O/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | ZKMNUMMKYBVTFN-HNNXBMFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-ropivacaine (CHEBI:8890) has role local anaesthetic (CHEBI:36333) |
| (S)-ropivacaine (CHEBI:8890) is a piperidinecarboxamide (CHEBI:48592) |
| (S)-ropivacaine (CHEBI:8890) is a ropivacaine (CHEBI:60802) |
| Incoming Relation(s) |
| (S)-ropivacaine hydrochloride (anhydrous) (CHEBI:60803) has part (S)-ropivacaine (CHEBI:8890) |
| IUPAC Name |
|---|
| (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide |
| INNs | Source |
|---|---|
| ropivacaina | ChemIDplus |
| ropivacaine | ChemIDplus |
| ropivacainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (−)-1-propyl-2',6'-dimethyl-2-piperidylcarboxyanilide | ChemIDplus |
| (−)-1-propyl-2',6'-pipecoloxylidide | ChemIDplus |
| (S)-(−)-1-propyl-2',6'-pipecoloxylidide | ChEBI |
| Ropivacaine | KEGG COMPOUND |
| L-N-n-propylpipecolic acid-2,6-xylidide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5421606 | Reaxys |
| CAS:84057-95-4 | KEGG COMPOUND |
| CAS:84057-95-4 | ChemIDplus |
| Citations |
|---|