EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27N2O.Cl |
| Net Charge | 0 |
| Average Mass | 310.869 |
| Monoisotopic Mass | 310.18119 |
| SMILES | CCC[NH+]1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C17H26N2O.ClH/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3;/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20);1H/t15-;/m0./s1 |
| InChIKey | NDNSIBYYUOEUSV-RSAXXLAASA-N |
| Roles Classification |
|---|
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-ropivacaine hydrochloride (anhydrous) (CHEBI:60803) has part (S)-ropivacaine (CHEBI:8890) |
| (S)-ropivacaine hydrochloride (anhydrous) (CHEBI:60803) has role local anaesthetic (CHEBI:36333) |
| (S)-ropivacaine hydrochloride (anhydrous) (CHEBI:60803) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| (S)-ropivacaine hydrochloride hydrate (CHEBI:34954) has part (S)-ropivacaine hydrochloride (anhydrous) (CHEBI:60803) |
| IUPAC Names |
|---|
| (2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidinium chloride |
| (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| ropivacaine HCl | ChemIDplus |
| (S)-1-propyl-2-piperidylformo-2',6'-xylidide hydrochloride | ChEBI |
| (S)-ropivacaine HCl | ChEBI |
| ropivacaine monohydrochloride | ChemIDplus |
| ropivacaine hydrochloride | ChemIDplus |
| L-ropivacaine hydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB00296 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6023239 | Reaxys |
| CAS:98717-15-8 | ChemIDplus |