EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C32H53N2O4 |
| Net Charge | 0 |
| Average Mass | 609.690 |
| Monoisotopic Mass | 608.31887 |
| SMILES | [Br-].[H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](OC(C)=O)[C@@H]([N+]5(CC=C)CCCC5)C[C@@]34[H])[C@@]1(C)C[C@H](N1CCOCC1)[C@@H](O)C2 |
| InChI | InChI=1S/C32H53N2O4.BrH/c1-5-14-34(15-6-7-16-34)28-20-26-24-9-8-23-19-29(36)27(33-12-17-37-18-13-33)21-32(23,4)25(24)10-11-31(26,3)30(28)38-22(2)35;/h5,23-30,36H,1,6-21H2,2-4H3;1H/q+1;/p-1/t23-,24+,25-,26-,27-,28-,29-,30-,31-,32-;/m0./s1 |
| InChIKey | OYTJKRAYGYRUJK-FMCCZJBLSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | neuromuscular agent A drug used for its actions on skeletal muscle. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rocuronium bromide (CHEBI:8885) has parent hydride 5α-androstane (CHEBI:28859) |
| rocuronium bromide (CHEBI:8885) has part rocuronium (CHEBI:8884) |
| rocuronium bromide (CHEBI:8885) has role muscle relaxant (CHEBI:51371) |
| rocuronium bromide (CHEBI:8885) has role neuromuscular agent (CHEBI:51372) |
| rocuronium bromide (CHEBI:8885) is a organic bromide salt (CHEBI:48369) |
| rocuronium bromide (CHEBI:8885) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 17β-(acetyloxy)-3α-hydroxy-2β-(morpholin-4-yl)-16β-[1-(prop-2-en-1-yl)pyrrolidinium-1-yl]-5α-androstane |
| INN | Source |
|---|---|
| rocuronium bromide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1-Allyl-1-(3alpha,17beta-dihydroxy-2beta-morpholino-5alpha-androstan-16beta-yl)pyrrolidinium bromide, 17-acetate | ChemIDplus |
| 17β-acetoxy-16β-(1-allylpyrrolidinium-1-yl)-3α-hydroxy-2β-(morpholin-4-yl)-5αandrostane | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| D00765 | KEGG DRUG |
| DB00728 | DrugBank |
| Rocuronium_bromide | Wikipedia |
| CN101687905 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7161858 | Reaxys |
| CAS:119302-91-9 | KEGG DRUG |
| CAS:119302-91-9 | DrugBank |
| CAS:119302-91-9 | ChemIDplus |
| Citations |
|---|