EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(O)c(-c3c(O)cc4oc(-c5ccc(O)cc5)cc(=O)c4c3O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)23-11-22(37)29-26(39-23)12-20(35)27(30(29)38)17-7-14(3-6-18(17)33)24-10-21(36)28-19(34)8-16(32)9-25(28)40-24/h1-12,31-35,38H |
| InChIKey | BORWSEZUWHQTOK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhus succedanea (ncbitaxon:269721) | seed kernel (BTO:0000668) | PubMed (9806485) | |
| Selaginella delicatula (IPNI:232058-2) | whole plant (BTO:0001461) | PubMed (10843573) | |
| Thuja orientalis (ncbitaxon:58046) | fruit (BTO:0000486) | PubMed (19280159) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| robustaflavone (CHEBI:8881) has role anti-HBV agent (CHEBI:64951) |
| robustaflavone (CHEBI:8881) has role antineoplastic agent (CHEBI:35610) |
| robustaflavone (CHEBI:8881) has role antioxidant (CHEBI:22586) |
| robustaflavone (CHEBI:8881) has role metabolite (CHEBI:25212) |
| robustaflavone (CHEBI:8881) is a biflavonoid (CHEBI:50128) |
| robustaflavone (CHEBI:8881) is a hydroxyflavone (CHEBI:24698) |
| robustaflavone (CHEBI:8881) is a ring assembly (CHEBI:36820) |
| Incoming Relation(s) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) has functional parent robustaflavone (CHEBI:8881) |
| IUPAC Name |
|---|
| 6-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',6''-Biapigenin | KEGG COMPOUND |
| 6-(5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| Robustaflavone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001094 | KNApSAcK |
| C10179 | KEGG COMPOUND |
| LMPK12040005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1613734 | Reaxys |
| CAS:49620-13-5 | KEGG COMPOUND |
| CAS:49620-13-5 | ChemIDplus |
| Citations |
|---|