EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H24O10 |
| Net Charge | 0 |
| Average Mass | 580.545 |
| Monoisotopic Mass | 580.13695 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(OC)c(-c4c(OC)cc5oc(-c6ccc(O)cc6)cc(=O)c5c4O)c3)oc2c1 |
| InChI | InChI=1S/C33H24O10/c1-39-19-11-21(35)31-22(36)13-26(43-28(31)12-19)17-6-9-24(40-2)20(10-17)30-27(41-3)15-29-32(33(30)38)23(37)14-25(42-29)16-4-7-18(34)8-5-16/h4-15,34-35,38H,1-3H3 |
| InChIKey | NLSFVXZLJDUWJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Selaginella doederleinii (ncbitaxon:186426) | whole plant (BTO:0001461) | PubMed (18758121) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) has functional parent robustaflavone (CHEBI:8881) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) has role antineoplastic agent (CHEBI:35610) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) has role metabolite (CHEBI:25212) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) is a biflavonoid (CHEBI:50128) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) is a hydroxyflavone (CHEBI:24698) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) is a methoxyflavone (CHEBI:25241) |
| robustaflavone 7,4',7''-trimethyl ether (CHEBI:66308) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 5-hydroxy-6-[5-(5-hydroxy-7-methoxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19422339 | Reaxys |
| Citations |
|---|