EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CC/C=C\C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h3-4,6-11,14-15,18-19,21-22H,2,5,12-13,16-17H2,1H3,(H,23,24)/b4-3-,8-7+,9-6-,14-10+,15-11-/t18-,19-/m1/s1 |
| InChIKey | BISQPGCQOHLHQK-HDNPQISLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (16424411) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (3025936) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene B5 (CHEBI:88493) has role anti-inflammatory agent (CHEBI:67079) |
| leukotriene B5 (CHEBI:88493) has role human xenobiotic metabolite (CHEBI:76967) |
| leukotriene B5 (CHEBI:88493) has role rat metabolite (CHEBI:86264) |
| leukotriene B5 (CHEBI:88493) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| leukotriene B5 (CHEBI:88493) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| leukotriene B5 (CHEBI:88493) is a leukotriene (CHEBI:25029) |
| leukotriene B5 (CHEBI:88493) is a long-chain fatty acid (CHEBI:15904) |
| leukotriene B5 (CHEBI:88493) is conjugate acid of leukotriene B5(1−) (CHEBI:133302) |
| Incoming Relation(s) |
| leukotriene B5(1−) (CHEBI:133302) is conjugate base of leukotriene B5 (CHEBI:88493) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z,17Z)-5,12-dihydroxyicosa-6,8,10,14,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-6,8,10,14,17-Eicosapentaenoic acid | HMDB |
| LTB5 | HMDB |
| 5,12-DiHEPE | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0005073 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:80445-66-5 | ChemIDplus |
| Citations |
|---|