EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O4 |
| Net Charge | -1 |
| Average Mass | 333.448 |
| Monoisotopic Mass | 333.20713 |
| SMILES | CC/C=C\C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h3-4,6-11,14-15,18-19,21-22H,2,5,12-13,16-17H2,1H3,(H,23,24)/p-1/b4-3-,8-7+,9-6-,14-10+,15-11-/t18-,19-/m1/s1 |
| InChIKey | BISQPGCQOHLHQK-HDNPQISLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene B5(1−) (CHEBI:133302) has functional parent leukotriene A5(1−) (CHEBI:234473) |
| leukotriene B5(1−) (CHEBI:133302) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| leukotriene B5(1−) (CHEBI:133302) is a icosanoid anion (CHEBI:62937) |
| leukotriene B5(1−) (CHEBI:133302) is conjugate base of leukotriene B5 (CHEBI:88493) |
| Incoming Relation(s) |
| leukotriene B5 (CHEBI:88493) is conjugate acid of leukotriene B5(1−) (CHEBI:133302) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z,17Z)-5,12-dihydroxyicosa-6,8,10,14,17-pentaenoate |
| Synonyms | Source |
|---|---|
| 5,12-DiHEPE(1−) | SUBMITTER |
| leukotriene B5 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| leukotriene B5 | UniProt |