EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C168H293N67O42 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 3923.554 |
| Monoisotopic Mass (excl. R groups) | 3921.28511 |
| SMILES | *N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(N)=O)[C@@H](C)O)C(C)C)[C@@H](C)O)[C@@H](C)O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | c-Jun N-terminal kinase inhibitor An EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor that inhibits the action of c-Jun N-terminal kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JNK inhibitor I (CHEBI:88340) has role c-Jun N-terminal kinase inhibitor (CHEBI:90172) |
| JNK inhibitor I (CHEBI:88340) is a peptidyl amide (CHEBI:15722) |
| JNK inhibitor I (CHEBI:88340) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| EMD 420116 | ChEBI |
| EMD-420116 | ChEBI |
| H-Gly-Arg-(Lys)2-(Arg)2-Gln-(Arg)3-(Pro)2-Arg-Pro-Lys-Arg-Pro-(Thr)2-Leu-Asn-Leu-Phe-Pro-Gln-Val-Pro-Arg-Ser-Gln-Asp-Thr-NH2 | ChEBI |
| H-GRKKRRQRRRPPRPKRPTTLNLFPQVPRSQDT-NH2 | ChEBI |
| JNK inhibitor 1 | ChEBI |
| SAPK Inhibitor 1 | ChEBI |
| Citations |
|---|