EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26O3 |
| Net Charge | 0 |
| Average Mass | 398.502 |
| Monoisotopic Mass | 398.18819 |
| SMILES | O=C(O)c1ccc2cc(-c3ccc(O)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2c1 |
| InChI | InChI=1S/C27H26O3/c28-25-6-5-22(20-1-2-21-11-23(26(29)30)4-3-19(21)10-20)12-24(25)27-13-16-7-17(14-27)9-18(8-16)15-27/h1-6,10-12,16-18,28H,7-9,13-15H2,(H,29,30) |
| InChIKey | LDGIHZJOIQSHPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. retinoic acid receptor gamma agonist Any retinoic acid receptor (RAR) agonist with specificity for RARγ. |
| Application: | retinoic acid receptor gamma agonist Any retinoic acid receptor (RAR) agonist with specificity for RARγ. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CD437 (CHEBI:88334) has role apoptosis inducer (CHEBI:68495) |
| CD437 (CHEBI:88334) has role retinoic acid receptor γ agonist (CHEBI:88336) |
| CD437 (CHEBI:88334) is a adamantanes (CHEBI:51339) |
| CD437 (CHEBI:88334) is a monocarboxylic acid (CHEBI:25384) |
| CD437 (CHEBI:88334) is a naphthoic acid (CHEBI:25483) |
| CD437 (CHEBI:88334) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| adapalene (CHEBI:31174) has functional parent CD437 (CHEBI:88334) |
| IUPAC Name |
|---|
| 6-(3-adamantan-1-yl-4-hydroxyphenyl)naphthalene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-[4-hydroxy-3-(tricyclo[3.3.1.13,7]dec-1-yl)phenyl]naphthalene-2-carboxylic acid | IUPAC |
| AHPN | ChEBI |
| Cd 437 | ChemIDplus |
| Apoptosis Activator VI | ChEBI |
| 6-[4-hydroxy-3-(tricyclo[3.3.1.13,7]dec-1-yl)phenyl]-2-naphthalenecarboxylic acid | ChemIDplus |
| CD-437 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-6237 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7445028 | Reaxys |
| CAS:125316-60-1 | ChemIDplus |
| Citations |
|---|