EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31174 - adapalene
| Formula | C28H28O3 |
| Net Charge | 0 |
| Average Mass | 412.529 |
| Monoisotopic Mass | 412.20384 |
| SMILES | COc1ccc(-c2ccc3cc(C(=O)O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H28O3/c1-31-26-7-6-23(21-2-3-22-12-24(27(29)30)5-4-20(22)11-21)13-25(26)28-14-17-8-18(15-28)10-19(9-17)16-28/h2-7,11-13,17-19H,8-10,14-16H2,1H3,(H,29,30) |
| InChIKey | LZCDAPDGXCYOEH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adapalene (CHEBI:31174) has functional parent CD437 (CHEBI:88334) |
| adapalene (CHEBI:31174) has role dermatologic drug (CHEBI:50177) |
| adapalene (CHEBI:31174) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| adapalene (CHEBI:31174) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| adapalene (CHEBI:31174) is a adamantanes (CHEBI:51339) |
| adapalene (CHEBI:31174) is a monocarboxylic acid (CHEBI:25384) |
| adapalene (CHEBI:31174) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 6-(3-adamantan-1-yl-4-methoxyphenyl)naphthalene-2-carboxylic acid |
| INNs | Source |
|---|---|
| adapalene | ChemIDplus |
| adapaleno | ChemIDplus |
| adapalenum | ChemIDplus |
| adapalène | ChEBI |
| Synonym | Source |
|---|---|
| 6-(3-(1-Adamantyl)-4-methoxyphenyl)-2-naphthoic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Adaferin | DrugBank |
| Differine | DrugBank |
| Citations |
|---|