EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H27N5O12S3 |
| Net Charge | 0 |
| Average Mass | 793.814 |
| Monoisotopic Mass | 793.08183 |
| SMILES | COc1cc(N=Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c23)c(C)cc1N=Nc1c(S(=O)(=O)O)cc2cc(Nc3ccccc3)ccc2c1O |
| InChI | InChI=1S/C34H27N5O12S3/c1-18-10-27(37-39-33-31(54(48,49)50)14-19-11-22(8-9-25(19)34(33)41)35-21-6-4-3-5-7-21)30(51-2)17-26(18)36-38-28-15-23(52(42,43)44)12-20-13-24(53(45,46)47)16-29(40)32(20)28/h3-17,35,40-41H,1-2H3,(H,42,43,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | OJWWQROAEXSSTO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Durazol blue 4R (acid form) (CHEBI:88284) has role fluorochrome (CHEBI:51217) |
| Durazol blue 4R (acid form) (CHEBI:88284) has role histological dye (CHEBI:77178) |
| Durazol blue 4R (acid form) (CHEBI:88284) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| Durazol blue 4R (acid form) (CHEBI:88284) is a aromatic ether (CHEBI:35618) |
| Durazol blue 4R (acid form) (CHEBI:88284) is a azobenzenes (CHEBI:22682) |
| Durazol blue 4R (acid form) (CHEBI:88284) is a bis(azo) compound (CHEBI:48960) |
| Durazol blue 4R (acid form) (CHEBI:88284) is a naphthols (CHEBI:25392) |
| Durazol blue 4R (acid form) (CHEBI:88284) is a secondary amino compound (CHEBI:50995) |
| Durazol blue 4R (acid form) (CHEBI:88284) is conjugate acid of Durazol blue 4R(3−) (CHEBI:88287) |
| Incoming Relation(s) |
| Durazol blue 4R(3−) (CHEBI:88287) is conjugate base of Durazol blue 4R (acid form) (CHEBI:88284) |
| IUPAC Name |
|---|
| 4-({4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-methoxy-2-methylphenyl}diazenyl)-5-hydroxynaphthalene-2,7-disulfonic acid |
| Synonyms | Source |
|---|---|
| direct blue 67 (acid form) | ChEBI |
| direct blue 67 free acid | ChEBI |
| Durazol blue 4R free acid | ChEBI |
| NSC 47755 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20756637 | Reaxys |