EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO8P2 |
| Net Charge | 0 |
| Average Mass | 287.101 |
| Monoisotopic Mass | 286.99599 |
| SMILES | NCc1cc(COP(=O)(O)OP(=O)(O)O)co1 |
| InChI | InChI=1S/C6H11NO8P2/c7-2-6-1-5(3-13-6)4-14-17(11,12)15-16(8,9)10/h1,3H,2,4,7H2,(H,11,12)(H2,8,9,10) |
| InChIKey | CWYTWLWLMJSIBB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanocaldococcus jannaschii (ncbitaxon:2190) | - | PubMed (26100040) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) has role bacterial metabolite (CHEBI:76969) |
| [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) is a furans (CHEBI:24129) |
| [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) is a organic diphosphate (CHEBI:62889) |
| [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) is a primary amino compound (CHEBI:50994) |
| [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) is conjugate acid of [5-(ammoniomethyl)-3-furyl]methyl diphosphate(2−) (CHEBI:88054) |
| Incoming Relation(s) |
| [5-(ammoniomethyl)-3-furyl]methyl diphosphate(2−) (CHEBI:88054) is conjugate base of [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) |
| IUPAC Name |
|---|
| [5-(aminomethyl)furan-3-yl]methyl trihydrogen diphosphate |
| Manual Xrefs | Databases |
|---|---|
| CPD-17180 | MetaCyc |
| Citations |
|---|