EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO8P2 |
| Net Charge | -2 |
| Average Mass | 285.085 |
| Monoisotopic Mass | 284.98144 |
| SMILES | [NH3+]Cc1cc(COP(=O)([O-])OP(=O)([O-])[O-])co1 |
| InChI | InChI=1S/C6H11NO8P2/c7-2-6-1-5(3-13-6)4-14-17(11,12)15-16(8,9)10/h1,3H,2,4,7H2,(H,11,12)(H2,8,9,10)/p-2 |
| InChIKey | CWYTWLWLMJSIBB-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [5-(ammoniomethyl)-3-furyl]methyl diphosphate(2−) (CHEBI:88054) is a organophosphate oxoanion (CHEBI:58945) |
| [5-(ammoniomethyl)-3-furyl]methyl diphosphate(2−) (CHEBI:88054) is conjugate base of [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) |
| Incoming Relation(s) |
| [5-(aminomethyl)-3-furyl]methyl diphosphate (CHEBI:88247) is conjugate acid of [5-(ammoniomethyl)-3-furyl]methyl diphosphate(2−) (CHEBI:88054) |
| UniProt Name | Source |
|---|---|
| [5-(aminomethyl)furan-3-yl]methyl diphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17180 | MetaCyc |
| Citations |
|---|