EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H10N2O8S |
| Net Charge | -2 |
| Average Mass | 426.362 |
| Monoisotopic Mass | 426.01688 |
| SMILES | Nc1c(S(=O)(=O)[O-])cc2c3c(cccc13)C(=O)N(c1ccc(O)c(C(=O)[O-])c1)C2=O |
| InChI | InChI=1S/C19H12N2O8S/c20-16-9-2-1-3-10-15(9)12(7-14(16)30(27,28)29)18(24)21(17(10)23)8-4-5-13(22)11(6-8)19(25)26/h1-7,22H,20H2,(H,25,26)(H,27,28,29)/p-2 |
| InChIKey | YJRPOOSSHYJYMO-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chrome fast yellow 8GL(2−) (CHEBI:88199) is a monohydroxybenzoate (CHEBI:25388) |
| Chrome fast yellow 8GL(2−) (CHEBI:88199) is a organosulfonate oxoanion (CHEBI:33554) |
| Chrome fast yellow 8GL(2−) (CHEBI:88199) is conjugate base of Chrome fast yellow 8GL (acid form) (CHEBI:88198) |
| Incoming Relation(s) |
| Chrome fast yellow 8GL (CHEBI:88197) has part Chrome fast yellow 8GL(2−) (CHEBI:88199) |
| Chrome fast yellow 8GL (acid form) (CHEBI:88198) is conjugate acid of Chrome fast yellow 8GL(2−) (CHEBI:88199) |
| IUPAC Name |
|---|
| 5-(6-amino-1,3-dioxo-5-sulfonato-1H-benzo[de]isoquinolin-2(3H)-yl)-2-hydroxybenzoate |
| Synonym | Source |
|---|---|
| Chrome fast yellow 8GL dianion | ChEBI |