EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H10N2O8S.2Na |
| Net Charge | 0 |
| Average Mass | 472.342 |
| Monoisotopic Mass | 471.99532 |
| SMILES | Nc1c(S(=O)(=O)[O-])cc2c3c(cccc13)C(=O)N(c1ccc(O)c(C(=O)[O-])c1)C2=O.[Na+].[Na+] |
| InChI | InChI=1S/C19H12N2O8S.2Na/c20-16-9-2-1-3-10-15(9)12(7-14(16)30(27,28)29)18(24)21(17(10)23)8-4-5-13(22)11(6-8)19(25)26;;/h1-7,22H,20H2,(H,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | SQOPFBRXWVNBMF-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chrome fast yellow 8GL (CHEBI:88197) has part Chrome fast yellow 8GL(2−) (CHEBI:88199) |
| Chrome fast yellow 8GL (CHEBI:88197) has role fluorochrome (CHEBI:51217) |
| Chrome fast yellow 8GL (CHEBI:88197) has role histological dye (CHEBI:77178) |
| Chrome fast yellow 8GL (CHEBI:88197) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5-(6-amino-1,3-dioxo-5-sulfonato-1H-benzo[de]isoquinolin-2(3H)-yl)-2-hydroxybenzoate |
| Synonyms | Source |
|---|---|
| C.I. 56210 | ChEBI |
| Chrome luxine yellow 5G | ChEBI |
| Mordant yellow 33 | ChEBI |
| Luxine pure yellow 6G | ChEBI |