EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28N6O16S4 |
| Net Charge | 0 |
| Average Mass | 904.892 |
| Monoisotopic Mass | 904.04446 |
| SMILES | COc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(N)c4c3O)c(OC)c2)ccc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(N)c2c1O |
| InChI | InChI=1S/C34H28N6O16S4/c1-55-25-9-15(3-5-23(25)37-39-31-27(59(49,50)51)11-17-7-19(57(43,44)45)13-21(35)29(17)33(31)41)16-4-6-24(26(10-16)56-2)38-40-32-28(60(52,53)54)12-18-8-20(58(46,47)48)14-22(36)30(18)34(32)42/h3-14,41-42H,35-36H2,1-2H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54)/b39-37+,40-38+ |
| InChIKey | KIZIRROTJQVUGJ-HVMBLDELSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) has role carcinogenic agent (CHEBI:50903) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) has role fluorochrome (CHEBI:51217) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) has role histological dye (CHEBI:77178) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) is a aromatic ether (CHEBI:35618) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) is a azobenzenes (CHEBI:22682) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) is a bis(azo) compound (CHEBI:48960) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) is a naphthols (CHEBI:25392) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) is a ring assembly (CHEBI:36820) |
| Pontamine sky blue 5B (acid form) (CHEBI:88195) is conjugate acid of Pontamine sky blue 5B(4−) (CHEBI:88196) |
| Incoming Relation(s) |
| Pontamine sky blue 5B(4−) (CHEBI:88196) is conjugate base of Pontamine sky blue 5B (acid form) (CHEBI:88195) |
| IUPAC Name |
|---|
| 3,3'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(diazene-2,1-diyl)]bis(5-amino-4-hydroxynaphthalene-2,7-disulfonic acid) |
| Synonyms | Source |
|---|---|
| C.I. Direct Blue 15 (acid form) | ChEBI |
| C.I. Direct Blue 15 free acid | ChEBI |
| Pontamine sky blue 5B free acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:740802 | Reaxys |