EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N2 |
| Net Charge | +1 |
| Average Mass | 385.575 |
| Monoisotopic Mass | 385.26383 |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H33N2/c1-5-28(6-2)25-18-14-23(15-19-25)27(22-12-10-9-11-13-22)24-16-20-26(21-17-24)29(7-3)8-4/h9-21H,5-8H2,1-4H3/q+1 |
| InChIKey | HXCILVUBKWANLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brilliant green cation (CHEBI:88176) has role antibacterial agent (CHEBI:33282) |
| brilliant green cation (CHEBI:88176) has role antiseptic drug (CHEBI:48218) |
| brilliant green cation (CHEBI:88176) has role environmental contaminant (CHEBI:78298) |
| brilliant green cation (CHEBI:88176) has role fluorochrome (CHEBI:51217) |
| brilliant green cation (CHEBI:88176) has role histological dye (CHEBI:77178) |
| brilliant green cation (CHEBI:88176) has role poison (CHEBI:64909) |
| brilliant green cation (CHEBI:88176) is a iminium ion (CHEBI:35286) |
| Incoming Relation(s) |
| brilliant green (CHEBI:88173) has part brilliant green cation (CHEBI:88176) |
| IUPAC Name |
|---|
| 4-{[4-(diethylamino)phenyl](phenyl)methylidene}-N,N-diethylcyclohexa-2,5-dien-1-iminium |
| Synonym | Source |
|---|---|
| brilliant green(1+) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4665 | DrugCentral |