EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N2.HO4S |
| Net Charge | 0 |
| Average Mass | 482.646 |
| Monoisotopic Mass | 482.22393 |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccccc2)cc1.O=S(=O)([O-])O |
| InChI | InChI=1S/C27H33N2.H2O4S/c1-5-28(6-2)25-18-14-23(15-19-25)27(22-12-10-9-11-13-22)24-16-20-26(21-17-24)29(7-3)8-4;1-5(2,3)4/h9-21H,5-8H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | NNBFNNNWANBMTI-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brilliant green (CHEBI:88173) has part brilliant green cation (CHEBI:88176) |
| brilliant green (CHEBI:88173) has role antibacterial agent (CHEBI:33282) |
| brilliant green (CHEBI:88173) has role antiseptic drug (CHEBI:48218) |
| brilliant green (CHEBI:88173) has role environmental contaminant (CHEBI:78298) |
| brilliant green (CHEBI:88173) has role fluorochrome (CHEBI:51217) |
| brilliant green (CHEBI:88173) has role histological dye (CHEBI:77178) |
| brilliant green (CHEBI:88173) has role poison (CHEBI:64909) |
| brilliant green (CHEBI:88173) is a organic hydrogensulfate salt (CHEBI:88175) |
| IUPAC Name |
|---|
| 4-{[4-(diethylamino)phenyl](phenyl)methylidene}-N,N-diethylcyclohexa-2,5-dien-1-iminium hydrogen sulfate |
| Synonyms | Source |
|---|---|
| (4-(4-(Diethylamino)benzhydrylene)cyclohexa-2,5-dien-1-ylidene)diethylammonium hydrogen sulphate | ChemIDplus |
| Basic green 1 | ChEBI |
| C.I. 42040 | ChEBI |
| C.I. Basic Green 1 | ChemIDplus |
| Malachite green G | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Brilliant_Green_(dye) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:633-03-4 | ChemIDplus |
| Citations |
|---|