EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@@H]1NCC[C@@H]1O |
| InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m0/s1 |
| InChIKey | BJBUEDPLEOHJGE-IUYQGCFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (22528483) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-3-hydroxy-D-proline (CHEBI:88157) has role bacterial metabolite (CHEBI:76969) |
| cis-3-hydroxy-D-proline (CHEBI:88157) has role human metabolite (CHEBI:77746) |
| cis-3-hydroxy-D-proline (CHEBI:88157) is a D-proline derivative (CHEBI:84185) |
| cis-3-hydroxy-D-proline (CHEBI:88157) is a 3-hydroxyproline (CHEBI:64368) |
| cis-3-hydroxy-D-proline (CHEBI:88157) is tautomer of cis-3-hydroxy-D-proline zwitterion (CHEBI:87840) |
| Incoming Relation(s) |
| cis-3-hydroxy-D-proline zwitterion (CHEBI:87840) is tautomer of cis-3-hydroxy-D-proline (CHEBI:88157) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-D-proline |
| Synonym | Source |
|---|---|
| (+)-cis-(2R,3S)-3-hydroxyproline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:471961 | Reaxys |
| Citations |
|---|