EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C([O-])[C@@H]1[NH2+]CC[C@@H]1O |
| InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m0/s1 |
| InChIKey | BJBUEDPLEOHJGE-IUYQGCFVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-3-hydroxy-D-proline zwitterion (CHEBI:87840) is a amino-acid zwitterion (CHEBI:35238) |
| cis-3-hydroxy-D-proline zwitterion (CHEBI:87840) is tautomer of cis-3-hydroxy-D-proline (CHEBI:88157) |
| Incoming Relation(s) |
| cis-3-hydroxy-D-proline (CHEBI:88157) is tautomer of cis-3-hydroxy-D-proline zwitterion (CHEBI:87840) |
| IUPAC Name |
|---|
| (2R,3S)-3-hydroxypyrrolidin-1-ium-2-carboxylate |
| UniProt Name | Source |
|---|---|
| cis-3-hydroxy-D-proline | UniProt |
| Citations |
|---|