EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N2O5 |
| Net Charge | 0 |
| Average Mass | 376.453 |
| Monoisotopic Mass | 376.19982 |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCC(=O)OC)CC1 |
| InChI | InChI=1S/C20H28N2O5/c1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2/h5-9H,4,10-15H2,1-3H3 |
| InChIKey | ZTVQQQVZCWLTDF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remifentanil (CHEBI:8802) has role intravenous anaesthetic (CHEBI:38877) |
| remifentanil (CHEBI:8802) has role opioid analgesic (CHEBI:35482) |
| remifentanil (CHEBI:8802) has role sedative (CHEBI:35717) |
| remifentanil (CHEBI:8802) has role μ-opioid receptor agonist (CHEBI:55322) |
| remifentanil (CHEBI:8802) is a anilide (CHEBI:13248) |
| remifentanil (CHEBI:8802) is a monocarboxylic acid amide (CHEBI:29347) |
| remifentanil (CHEBI:8802) is a piperidinecarboxylate ester (CHEBI:48630) |
| remifentanil (CHEBI:8802) is a α-amino acid ester (CHEBI:46874) |
| Incoming Relation(s) |
| remifentanil hydrochloride (CHEBI:32091) has part remifentanil (CHEBI:8802) |
| IUPAC Name |
|---|
| methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate |
| INN | Source |
|---|---|
| remifentanil | ChemIDplus |
| Synonyms | Source |
|---|---|
| Remifentanil | KEGG COMPOUND |
| REMIFENTANIL | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2363 | DrugCentral |
| C08021 | KEGG COMPOUND |
| D08473 | KEGG DRUG |
| DB00899 | DrugBank |
| EP383579 | Patent |
| HMDB0015036 | HMDB |
| Remifentanil | Wikipedia |
| US5019583 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4358750 | Reaxys |
| CAS:132875-61-7 | KEGG COMPOUND |
| CAS:132875-61-7 | ChemIDplus |