EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8802 - remifentanil
| Formula | C20H28N2O5 |
| Net Charge | 0 |
| Average Mass | 376.453 |
| Monoisotopic Mass | 376.19982 |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCC(=O)OC)CC1 |
| InChI | InChI=1S/C20H28N2O5/c1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2/h5-9H,4,10-15H2,1-3H3 |
| InChIKey | ZTVQQQVZCWLTDF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remifentanil (CHEBI:8802) has role analgesic (CHEBI:35480) |
| remifentanil (CHEBI:8802) has role anti-obesity agent (CHEBI:74518) |
| remifentanil (CHEBI:8802) has role antineoplastic agent (CHEBI:35610) |
| remifentanil (CHEBI:8802) has role cardiovascular drug (CHEBI:35554) |
| remifentanil (CHEBI:8802) has role intravenous anaesthetic (CHEBI:38877) |
| remifentanil (CHEBI:8802) has role opioid analgesic (CHEBI:35482) |
| remifentanil (CHEBI:8802) has role sedative (CHEBI:35717) |
| remifentanil (CHEBI:8802) has role μ-opioid receptor agonist (CHEBI:55322) |
| remifentanil (CHEBI:8802) is a anilide (CHEBI:13248) |
| remifentanil (CHEBI:8802) is a monocarboxylic acid amide (CHEBI:29347) |
| remifentanil (CHEBI:8802) is a piperidinecarboxylate ester (CHEBI:48630) |
| remifentanil (CHEBI:8802) is a α-amino acid ester (CHEBI:46874) |
| Incoming Relation(s) |
| remifentanil hydrochloride (CHEBI:32091) has part remifentanil (CHEBI:8802) |
| IUPAC Name |
|---|
| methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate |
| INNs | Source |
|---|---|
| remifentanil | ChemIDplus |
| remifentanilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| GI 87084X | ChEMBL |
| IDS-NR-005 | ChEMBL |
| Remifentanil | KEGG COMPOUND |
| REMIFENTANIL | ChEMBL |
| Ultiva- | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2363 | DrugCentral |
| C08021 | KEGG COMPOUND |
| D08473 | KEGG DRUG |
| DB00899 | DrugBank |
| EP383579 | Patent |
| HMDB0015036 | HMDB |
| Remifentanil | Wikipedia |
| US5019583 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4358750 | Reaxys |
| CAS:132875-61-7 | KEGG COMPOUND |
| CAS:132875-61-7 | ChemIDplus |
| Citations |
|---|