EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N2O5.Cl |
| Net Charge | 0 |
| Average Mass | 412.914 |
| Monoisotopic Mass | 412.17650 |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CC[NH+](CCC(=O)OC)CC1.[Cl-] |
| InChI | InChI=1S/C20H28N2O5.ClH/c1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2;/h5-9H,4,10-15H2,1-3H3;1H |
| InChIKey | WFBMIPUMYUHANP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| remifentanil hydrochloride (CHEBI:32091) has part remifentanil (CHEBI:8802) |
| remifentanil hydrochloride (CHEBI:32091) has role intravenous anaesthetic (CHEBI:38877) |
| remifentanil hydrochloride (CHEBI:32091) has role opioid analgesic (CHEBI:35482) |
| remifentanil hydrochloride (CHEBI:32091) has role sedative (CHEBI:35717) |
| remifentanil hydrochloride (CHEBI:32091) has role μ-opioid receptor agonist (CHEBI:55322) |
| remifentanil hydrochloride (CHEBI:32091) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 4-(methoxycarbonyl)-1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidinium chloride |
| methyl 1-(3-methoxy-3-oxopropyl)-4-[phenyl(propanoyl)amino]piperidine-4-carboxylate hydrochloride |
| Synonym | Source |
|---|---|
| remifentanil HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Ultiva | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8660300 | Reaxys |
| CAS:132539-07-2 | KEGG DRUG |
| CAS:132539-07-2 | ChemIDplus |