EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16N6O12S3 |
| Net Charge | 0 |
| Average Mass | 652.601 |
| Monoisotopic Mass | 651.99883 |
| SMILES | Nc1c(/N=N/c2ccc([N+](=O)[O-])cc2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(S(=O)(=O)O)cc3)c(O)c12 |
| InChI | InChI=1S/C22H16N6O12S3/c23-19-18-11(9-16(42(35,36)37)20(19)26-24-12-1-5-14(6-2-12)28(30)31)10-17(43(38,39)40)21(22(18)29)27-25-13-3-7-15(8-4-13)41(32,33)34/h1-10,29H,23H2,(H,32,33,34)(H,35,36,37)(H,38,39,40)/b26-24+,27-25+ |
| InChIKey | TWXYZBYSOWJDEU-OWUYFMIJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naphthalene blue black CS (acid form) (CHEBI:88019) has role fluorochrome (CHEBI:51217) |
| naphthalene blue black CS (acid form) (CHEBI:88019) has role histological dye (CHEBI:77178) |
| naphthalene blue black CS (acid form) (CHEBI:88019) is a C-nitro compound (CHEBI:35716) |
| naphthalene blue black CS (acid form) (CHEBI:88019) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| naphthalene blue black CS (acid form) (CHEBI:88019) is a azobenzenes (CHEBI:22682) |
| naphthalene blue black CS (acid form) (CHEBI:88019) is a bis(azo) compound (CHEBI:48960) |
| naphthalene blue black CS (acid form) (CHEBI:88019) is a naphthols (CHEBI:25392) |
| naphthalene blue black CS (acid form) (CHEBI:88019) is conjugate acid of 4-amino-5-hydroxy-3-[(4-nitrophenyl)diazenyl]-6-[(4-sulfonatophenyl)diazenyl]naphthalene-2,7-disulfonate (CHEBI:88024) |
| Incoming Relation(s) |
| 4-amino-5-hydroxy-3-[(4-nitrophenyl)diazenyl]-6-[(4-sulfonatophenyl)diazenyl]naphthalene-2,7-disulfonate (CHEBI:88024) is conjugate base of naphthalene blue black CS (acid form) (CHEBI:88019) |
| IUPAC Name |
|---|
| 4-amino-5-hydroxy-3-[(4-nitrophenyl)diazenyl]-6-[(4-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| Synonyms | Source |
|---|---|
| acid black 41 (acid form) | ChEBI |
| blauschwartz NSF (acid form) | ChEBI |