EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O6 |
| Net Charge | -3 |
| Average Mass | 173.100 |
| Monoisotopic Mass | 173.01026 |
| SMILES | CCC(C(=O)[O-])(C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H8O6/c1-2-6(3(7)8,4(9)10)5(11)12/h2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/p-3 |
| InChIKey | CEGRHPCDLKAHJD-UHFFFAOYSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS171) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1,1-propanetricarboxylate (CHEBI:87985) is a tricarboxylic acid trianion (CHEBI:27092) |
| 1,1,1-propanetricarboxylate (CHEBI:87985) is conjugate base of 1,1,1-propanetricarboxylic acid (CHEBI:100148) |
| Incoming Relation(s) |
| 1,1,1-propanetricarboxylic acid (CHEBI:100148) is conjugate acid of 1,1,1-propanetricarboxylate (CHEBI:87985) |
| IUPAC Name |
|---|
| propane-1,1,1-tricarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 10608344 | ChemSpider |