EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | CCC(C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O6/c1-2-6(3(7)8,4(9)10)5(11)12/h2H2,1H3,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CEGRHPCDLKAHJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1,1-propanetricarboxylic acid (CHEBI:100148) is a tricarboxylic acid (CHEBI:27093) |
| 1,1,1-propanetricarboxylic acid (CHEBI:100148) is conjugate acid of 1,1,1-propanetricarboxylate (CHEBI:87985) |
| Incoming Relation(s) |
| 1,1,1-propanetricarboxylate (CHEBI:87985) is conjugate base of 1,1,1-propanetricarboxylic acid (CHEBI:100148) |
| Synonym | Source |
|---|---|
| propane-1,1,1-tricarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13832806 | Reaxys |