EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O8 |
| Net Charge | 0 |
| Average Mass | 300.263 |
| Monoisotopic Mass | 300.08452 |
| SMILES | O=C(O)c1ccccc1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16O8/c14-5-8-9(15)10(16)11(17)13(21-8)20-7-4-2-1-3-6(7)12(18)19/h1-4,8-11,13-17H,5H2,(H,18,19)/t8-,9-,10+,11-,13?/m1/s1 |
| InChIKey | TZPBMNKOLMSJPF-TWEVDUBQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(D-glucosyloxy)benzoic acid (CHEBI:87766) has functional parent salicylic acid (CHEBI:16914) |
| 2-(D-glucosyloxy)benzoic acid (CHEBI:87766) is a D-glucoside (CHEBI:35436) |
| 2-(D-glucosyloxy)benzoic acid (CHEBI:87766) is a benzoic acids (CHEBI:22723) |
| 2-(D-glucosyloxy)benzoic acid (CHEBI:87766) is a monosaccharide derivative (CHEBI:63367) |
| Incoming Relation(s) |
| 2-(β-D-glucopyranosyloxy)benzoic acid (CHEBI:145663) is a 2-(D-glucosyloxy)benzoic acid (CHEBI:87766) |
| IUPAC Names |
|---|
| 2-{[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}benzoic acid |
| 2-(D-glucopyranosyloxy)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-(D-glucopyranosyloxy)benzoic acid | ChEBI |
| O-glucosylsalicylic acid | ChEBI |
| salicylic acid glucopyranoside | ChEBI |
| salicylic acid glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27062329 | Reaxys |
| CAS:10366-91-3 | ChemIDplus |