EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O |
| Net Charge | 0 |
| Average Mass | 86.134 |
| Monoisotopic Mass | 86.07316 |
| SMILES | CCC(=O)CC |
| InChI | InChI=1S/C5H10O/c1-3-5(6)4-2/h3-4H2,1-2H3 |
| InChIKey | FDPIMTJIUBPUKL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Triatoma brasiliensis (ncbitaxon:65344) | gland (BTO:0000522) | PubMed (21486009) | metasternal glands |
| Triatoma infestans (ncbitaxon:30076) | gland (BTO:0000522) | PubMed (21486009) | metasternal glands |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentan-3-one (CHEBI:87755) has role animal metabolite (CHEBI:75767) |
| pentan-3-one (CHEBI:87755) is a pentanone (CHEBI:25892) |
| Incoming Relation(s) |
| 2,4-dimethyl-3-pentanone (CHEBI:87754) has functional parent pentan-3-one (CHEBI:87755) |
| IUPAC Name |
|---|
| pentan-3-one |
| Synonyms | Source |
|---|---|
| diethyl ketone | ChEBI |
| Ethyl propionyl | ChEBI |
| UniProt Name | Source |
|---|---|
| pentan-3-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3-Pentanone | Wikipedia |
| Citations |
|---|