EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O |
| Net Charge | 0 |
| Average Mass | 114.188 |
| Monoisotopic Mass | 114.10447 |
| SMILES | CC(C)C(=O)C(C)C |
| InChI | InChI=1S/C7H14O/c1-5(2)7(8)6(3)4/h5-6H,1-4H3 |
| InChIKey | HXVNBWAKAOHACI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dimethyl-3-pentanone (CHEBI:87754) has functional parent pentan-3-one (CHEBI:87755) |
| 2,4-dimethyl-3-pentanone (CHEBI:87754) has role metabolite (CHEBI:25212) |
| 2,4-dimethyl-3-pentanone (CHEBI:87754) is a pentanone (CHEBI:25892) |
| IUPAC Name |
|---|
| 2,4-dimethylpentan-3-one |