EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15O4.Na |
| Net Charge | 0 |
| Average Mass | 330.315 |
| Monoisotopic Mass | 330.08680 |
| SMILES | CC(=O)C[C@@H](c1ccccc1)c1c([O-])c2ccccc2oc1=O.[Na+] |
| InChI | InChI=1S/C19H16O4.Na/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22;/h2-10,15,21H,11H2,1H3;/q;+1/p-1/t15-;/m0./s1 |
| InChIKey | KYITYFHKDODNCQ-RSAXXLAASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-warfarin sodium (CHEBI:87740) has part (S)-warfarin(1−) (CHEBI:87744) |
| (S)-warfarin sodium (CHEBI:87740) is a organic sodium salt (CHEBI:38700) |
| (S)-warfarin sodium (CHEBI:87740) is enantiomer of (R)-warfarin sodium (CHEBI:87739) |
| Incoming Relation(s) |
| warfarin sodium (CHEBI:10034) has part (S)-warfarin sodium (CHEBI:87740) |
| (R)-warfarin sodium (CHEBI:87739) is enantiomer of (S)-warfarin sodium (CHEBI:87740) |
| IUPAC Name |
|---|
| sodium 2-oxo-3-[(1S)-3-oxo-1-phenylbutyl]-2H-1-benzopyran-4-olate |