EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20FNO3S |
| Net Charge | 0 |
| Average Mass | 373.449 |
| Monoisotopic Mass | 373.11479 |
| SMILES | CC(=O)Oc1cc2c(s1)CCN([C@H](C(=O)C1CC1)c1ccccc1F)C2 |
| InChI | InChI=1S/C20H20FNO3S/c1-12(23)25-18-10-14-11-22(9-8-17(14)26-18)19(20(24)13-6-7-13)15-4-2-3-5-16(15)21/h2-5,10,13,19H,6-9,11H2,1H3/t19-/m0/s1 |
| InChIKey | DTGLZDAWLRGWQN-IBGZPJMESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-prasugrel (CHEBI:87724) is a 5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl acetate (CHEBI:87723) |
| (S)-prasugrel (CHEBI:87724) is conjugate base of (S)-prasugrel(1+) (CHEBI:87726) |
| (S)-prasugrel (CHEBI:87724) is enantiomer of (R)-prasugrel (CHEBI:87725) |
| Incoming Relation(s) |
| prasugrel (CHEBI:87715) has part (S)-prasugrel (CHEBI:87724) |
| (S)-prasugrel(1+) (CHEBI:87726) is conjugate acid of (S)-prasugrel (CHEBI:87724) |
| (R)-prasugrel (CHEBI:87725) is enantiomer of (S)-prasugrel (CHEBI:87724) |
| IUPAC Name |
|---|
| 5-[(1S)-2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23246386 | Reaxys |