EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N3O4 |
| Net Charge | 0 |
| Average Mass | 427.545 |
| Monoisotopic Mass | 427.24711 |
| SMILES | COc1ccccc1OC[C@H](O)CN1CCN(CC(=O)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-18-7-6-8-19(2)24(18)25-23(29)16-27-13-11-26(12-14-27)15-20(28)17-31-22-10-5-4-9-21(22)30-3/h4-10,20,28H,11-17H2,1-3H3,(H,25,29)/t20-/m1/s1 |
| InChIKey | XKLMZUWKNUAPSZ-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-ranolazine (CHEBI:87696) is a N-(2,6-dimethylphenyl)-2-{4-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperazin-1-yl}acetamide (CHEBI:87690) |
| (R)-ranolazine (CHEBI:87696) is enantiomer of (S)-ranolazine (CHEBI:87693) |
| Incoming Relation(s) |
| ranolazine (CHEBI:87681) has part (R)-ranolazine (CHEBI:87696) |
| (S)-ranolazine (CHEBI:87693) is enantiomer of (R)-ranolazine (CHEBI:87696) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-2-{4-[(2R)-2-hydroxy-3-(2-methoxyphenoxy)propyl]piperazin-1-yl}acetamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24301425 | Reaxys |