EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N3 |
| Net Charge | +1 |
| Average Mass | 330.455 |
| Monoisotopic Mass | 330.19647 |
| SMILES | CC1=CC(=C(c2ccc(N)c(C)c2)c2ccc(N)c(C)c2)C=CC1=[NH2+] |
| InChI | InChI=1S/C22H23N3/c1-13-10-16(4-7-19(13)23)22(17-5-8-20(24)14(2)11-17)18-6-9-21(25)15(3)12-18/h4-12,23H,24-25H2,1-3H3/p+1 |
| InChIKey | MUFPRITXEIBEMS-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| new fuchsin(1+) (CHEBI:87674) is a iminium ion (CHEBI:35286) |
| new fuchsin(1+) (CHEBI:87674) is conjugate acid of new fuchsin free base (CHEBI:87672) |
| Incoming Relation(s) |
| new fuchsin (CHEBI:87671) has part new fuchsin(1+) (CHEBI:87674) |
| new fuchsin free base (CHEBI:87672) is conjugate base of new fuchsin(1+) (CHEBI:87674) |
| IUPAC Name |
|---|
| 4-[bis(4-amino-3-methylphenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-iminium |
| Synonym | Source |
|---|---|
| new fuchsin cation | ChEBI |