EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23N3.HCl |
| Net Charge | 0 |
| Average Mass | 365.908 |
| Monoisotopic Mass | 365.16588 |
| SMILES | CC1=CC(=C(c2ccc(N)c(C)c2)c2ccc(N)c(C)c2)C=CC1=N.Cl |
| InChI | InChI=1S/C22H23N3.ClH/c1-13-10-16(4-7-19(13)23)22(17-5-8-20(24)14(2)11-17)18-6-9-21(25)15(3)12-18;/h4-12,23H,24-25H2,1-3H3;1H |
| InChIKey | IPSIPYMEZZPCPY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| new fuchsin (CHEBI:87671) has part new fuchsin(1+) (CHEBI:87674) |
| new fuchsin (CHEBI:87671) has role fluorochrome (CHEBI:51217) |
| new fuchsin (CHEBI:87671) has role histological dye (CHEBI:77178) |
| new fuchsin (CHEBI:87671) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| basic fuchsin (CHEBI:87661) has part new fuchsin (CHEBI:87671) |
| IUPAC Names |
|---|
| 4,4'-[(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methylene]bis(2-methylaniline) hydrochloride |
| 4-[bis(4-amino-3-methylphenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| Basic violet 2 | ChEBI |
| C.I. 42520 | ChEBI |
| C.I. Basic Violet 2 | ChemIDplus |
| magenta III | ChEBI |
| Neofuchsine | ChemIDplus |
| New fuchsine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| New_fuchsine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8740867 | Reaxys |
| CAS:3248-91-7 | ChemIDplus |
| Citations |
|---|