EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N3 |
| Net Charge | +1 |
| Average Mass | 302.401 |
| Monoisotopic Mass | 302.16517 |
| SMILES | Cc1cc(C(=C2C=CC(=[NH2+])C=C2)c2ccc(N)cc2)ccc1N |
| InChI | InChI=1S/C20H19N3/c1-13-12-16(6-11-19(13)23)20(14-2-7-17(21)8-3-14)15-4-9-18(22)10-5-15/h2-12,21H,22-23H2,1H3/p+1/b20-14-,21-17? |
| InChIKey | WVYMEHMNEMRCEL-SFVWPUANSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosanilin(1+) (CHEBI:87667) is a iminium ion (CHEBI:35286) |
| rosanilin(1+) (CHEBI:87667) is conjugate acid of rosanilin free base (CHEBI:87666) |
| Incoming Relation(s) |
| rosanilin (CHEBI:87665) has part rosanilin(1+) (CHEBI:87667) |
| rosanilin free base (CHEBI:87666) is conjugate base of rosanilin(1+) (CHEBI:87667) |
| IUPAC Name |
|---|
| 4-[(4-amino-3-methylphenyl)(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-iminium |
| Synonym | Source |
|---|---|
| rosanilin cation | ChEBI |