EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N3.HCl |
| Net Charge | 0 |
| Average Mass | 337.854 |
| Monoisotopic Mass | 337.13458 |
| SMILES | Cc1cc(C(=C2C=CC(=N)C=C2)c2ccc(N)cc2)ccc1N.Cl |
| InChI | InChI=1S/C20H19N3.ClH/c1-13-12-16(6-11-19(13)23)20(14-2-7-17(21)8-3-14)15-4-9-18(22)10-5-15;/h2-12,21H,22-23H2,1H3;1H/b20-14-,21-17?; |
| InChIKey | NIKFYOSELWJIOF-SVFFXJIWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosanilin (CHEBI:87665) has part rosanilin(1+) (CHEBI:87667) |
| rosanilin (CHEBI:87665) has role carcinogenic agent (CHEBI:50903) |
| rosanilin (CHEBI:87665) has role fluorochrome (CHEBI:51217) |
| rosanilin (CHEBI:87665) has role histological dye (CHEBI:77178) |
| rosanilin (CHEBI:87665) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| basic fuchsin (CHEBI:87661) has part rosanilin (CHEBI:87665) |
| IUPAC Names |
|---|
| 4-[(4-amino-3-methylphenyl)(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-iminium chloride |
| 4-[(4-aminophenyl)(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]-2-methylaniline hydrochloride |
| Synonyms | Source |
|---|---|
| basic fuchsin | ChEBI |
| Basic magenta | ChemIDplus |
| basic violet 14 | ChEBI |
| C.I. 42510 | ChEBI |
| CI 42510 | ChemIDplus |
| C.I. Basic Violet 14 | ChemIDplus |
| Citations |
|---|