EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N8 |
| Net Charge | 0 |
| Average Mass | 346.398 |
| Monoisotopic Mass | 346.16544 |
| SMILES | Nc1ccc(N=Nc2cccc(N=Nc3ccc(N)cc3N)c2)c(N)c1 |
| InChI | InChI=1S/C18H18N8/c19-11-4-6-17(15(21)8-11)25-23-13-2-1-3-14(10-13)24-26-18-7-5-12(20)9-16(18)22/h1-10H,19-22H2 |
| InChIKey | BDFZFGDTHFGWRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| basic brown 1 (CHEBI:87654) has role fluorochrome (CHEBI:51217) |
| basic brown 1 (CHEBI:87654) has role histological dye (CHEBI:77178) |
| basic brown 1 (CHEBI:87654) is a azobenzenes (CHEBI:22682) |
| basic brown 1 (CHEBI:87654) is a bis(azo) compound (CHEBI:48960) |
| basic brown 1 (CHEBI:87654) is a substituted aniline (CHEBI:48975) |
| basic brown 1 (CHEBI:87654) is a tetramine (CHEBI:39166) |
| Incoming Relation(s) |
| Bismark brown Y (CHEBI:53615) has part basic brown 1 (CHEBI:87654) |
| IUPAC Name |
|---|
| 4,4'-[1,3-phenylenebis(diazene-2,1-diyl)]di(benzene-1,3-diamine) |
| Synonyms | Source |
|---|---|
| 4,4'-(1,3-Phenylenebis(azo))bis(1,3-benzenediamine) | ChemIDplus |
| Bismark brown Y free base | ChEBI |
| C.I. Basic Brown 1 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1829673 | Reaxys |
| CAS:1052-38-6 | ChemIDplus |
| Citations |
|---|