EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N8.2HCl |
| Net Charge | 0 |
| Average Mass | 419.320 |
| Monoisotopic Mass | 418.11880 |
| SMILES | Cl.Cl.Nc1ccc(N=Nc2cccc(N=Nc3ccc(N)cc3N)c2)c(N)c1 |
| InChI | InChI=1S/C18H18N8.2ClH/c19-11-4-6-17(15(21)8-11)25-23-13-2-1-3-14(10-13)24-26-18-7-5-12(20)9-16(18)22;;/h1-10H,19-22H2;2*1H |
| InChIKey | MCZVRBLCRZWFJH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bismark brown Y (CHEBI:53615) has part basic brown 1 (CHEBI:87654) |
| Bismark brown Y (CHEBI:53615) has role allergen (CHEBI:50904) |
| Bismark brown Y (CHEBI:53615) has role fluorochrome (CHEBI:51217) |
| Bismark brown Y (CHEBI:53615) has role histological dye (CHEBI:77178) |
| Bismark brown Y (CHEBI:53615) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4,4'-[1,3-phenylenebis(diazene-2,1-diyl)]di(benzene-1,3-diamine) dihydrochloride |
| Synonyms | Source |
|---|---|
| Basic brown 1 | ChEBI |
| Bismarck brown | ChEBI |
| Bismarck brown Y | ChEBI |
| C.I. 21000 | ChEBI |
| C.I. Basic Brown 1, dihydrochloride | ChemIDplus |
| Manchester brown | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bismarck_brown_Y | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8372091 | Reaxys |
| CAS:10114-58-6 | ChemIDplus |
| Citations |
|---|